C24H23BFNO2 — CID 102037804
1-[4-fluoro-2-[(4S)-4-methyl-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1R)-1-phenylethyl]methanimine (PubChem CID 102037804) has the molecular formula C24H23BFNO2 and a molecular weight of 387.26 g/mol. Its IUPAC name is 1-[4-fluoro-2-[(4S)-4-methyl-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1R)-1-phenylethyl]methanimine.
| Compound Name | 1-[4-fluoro-2-[(4S)-4-methyl-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1R)-1-phenylethyl]methanimine |
|---|---|
| PubChem CID | 102037804 |
| Molecular Formula | C24H23BFNO2 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-[4-fluoro-2-[(4S)-4-methyl-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1R)-1-phenylethyl]methanimine |
| SMILES | C[C@@H](/N=C/c1ccc(F)cc1B1OC[C@](C)(c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C24H23BFNO2/c1-18(19-9-5-3-6-10-19)27-16-20-13-14-22(26)15-23(20)25-28-17-24(2,29-25)21-11-7-4-8-12-21/h3-16,18H,17H2,1-2H3/b27-16+/t18-,24-/m1/s1 |
| InChIKey | SSNHUEQXHQOVSM-COFPISQPSA-N |
| XLogP | 4.66 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|