C24H36O4 — CID 102038240
(1S,5R,7R,8R,9S,11R,12S,13R,16S)-5,7,9,11,16-pentamethyl-15-methylidene-18,20-dioxatetracyclo[9.6.2.18,12.01,13]icosane-10,19-dione (PubChem CID 102038240) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (1S,5R,7R,8R,9S,11R,12S,13R,16S)-5,7,9,11,16-pentamethyl-15-methylidene-18,20-dioxatetracyclo[9.6.2.18,12.01,13]icosane-10,19-dione.
| Compound Name | (1S,5R,7R,8R,9S,11R,12S,13R,16S)-5,7,9,11,16-pentamethyl-15-methylidene-18,20-dioxatetracyclo[9.6.2.18,12.01,13]icosane-10,19-dione |
|---|---|
| PubChem CID | 102038240 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (1S,5R,7R,8R,9S,11R,12S,13R,16S)-5,7,9,11,16-pentamethyl-15-methylidene-18,20-dioxatetracyclo[9.6.2.18,12.01,13]icosane-10,19-dione |
| SMILES | C=C1C[C@@H]2[C@@H]3O[C@@H]4[C@H](C)C[C@H](C)CCC[C@@]2(C[C@@H]1C)OC(=O)[C@@]3(C)C(=O)[C@H]4C |
| InChI | InChI=1S/C24H36O4/c1-13-8-7-9-24-12-16(4)14(2)11-18(24)21-23(6,22(26)28-24)20(25)17(5)19(27-21)15(3)10-13/h13,15-19,21H,2,7-12H2,1,3-6H3/t13-,15-,16+,17+,18-,19-,21+,23+,24+/m1/s1 |
| InChIKey | UOAYBBWAEPUHPF-XQDIWWFGSA-N |
| XLogP | 4.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|