C26H32N6OS — CID 102038379
4-[2-[4-(2-cyclohexyl-1H-benzimidazol-4-yl)piperazin-1-yl]ethoxy]-1,3-dihydrobenzimidazole-2-thione (PubChem CID 102038379) has the molecular formula C26H32N6OS and a molecular weight of 476.65 g/mol. Its IUPAC name is 4-[2-[4-(2-cyclohexyl-1H-benzimidazol-4-yl)piperazin-1-yl]ethoxy]-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 4-[2-[4-(2-cyclohexyl-1H-benzimidazol-4-yl)piperazin-1-yl]ethoxy]-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 102038379 |
| Molecular Formula | C26H32N6OS |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 4-[2-[4-(2-cyclohexyl-1H-benzimidazol-4-yl)piperazin-1-yl]ethoxy]-1,3-dihydrobenzimidazole-2-thione |
| SMILES | S=c1[nH]c2cccc(OCCN3CCN(c4cccc5[nH]c(C6CCCCC6)nc45)CC3)c2[nH]1 |
| InChI | InChI=1S/C26H32N6OS/c34-26-28-20-9-5-11-22(24(20)30-26)33-17-16-31-12-14-32(15-13-31)21-10-4-8-19-23(21)29-25(27-19)18-6-2-1-3-7-18/h4-5,8-11,18H,1-3,6-7,12-17H2,(H,27,29)(H2,28,30,34) |
| InChIKey | LBDWJJFGQVKUBV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|