C16H28O4 — CID 102038641
12-tert-butyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecane (PubChem CID 102038641) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 12-tert-butyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecane.
| Compound Name | 12-tert-butyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecane |
|---|---|
| PubChem CID | 102038641 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 12-tert-butyl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecane |
| SMILES | CC(C)(C)C1CCC2(CC1)OOC1(CCCCC1)OO2 |
| InChI | InChI=1S/C16H28O4/c1-14(2,3)13-7-11-16(12-8-13)19-17-15(18-20-16)9-5-4-6-10-15/h13H,4-12H2,1-3H3 |
| InChIKey | PXQLAKIMVYUQPC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|