C19H36O4 — CID 102038646
3,3-dibutyl-9-tert-butyl-1,2,4,5-tetraoxaspiro[5.5]undecane (PubChem CID 102038646) has the molecular formula C19H36O4 and a molecular weight of 328.49 g/mol. Its IUPAC name is 3,3-dibutyl-9-tert-butyl-1,2,4,5-tetraoxaspiro[5.5]undecane.
| Compound Name | 3,3-dibutyl-9-tert-butyl-1,2,4,5-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102038646 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 3,3-dibutyl-9-tert-butyl-1,2,4,5-tetraoxaspiro[5.5]undecane |
| SMILES | CCCCC1(CCCC)OOC2(CCC(C(C)(C)C)CC2)OO1 |
| InChI | InChI=1S/C19H36O4/c1-6-8-12-18(13-9-7-2)20-22-19(23-21-18)14-10-16(11-15-19)17(3,4)5/h16H,6-15H2,1-5H3 |
| InChIKey | KQIQGMCXWVWCFS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|