C20H21NO3 — CID 102039180
methyl (2S,3S,4R,5R)-4-acetyl-3,5-diphenylpyrrolidine-2-carboxylate (PubChem CID 102039180) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R)-4-acetyl-3,5-diphenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R)-4-acetyl-3,5-diphenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102039180 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | methyl (2S,3S,4R,5R)-4-acetyl-3,5-diphenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2ccccc2)[C@H](C(C)=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H21NO3/c1-13(22)16-17(14-9-5-3-6-10-14)19(20(23)24-2)21-18(16)15-11-7-4-8-12-15/h3-12,16-19,21H,1-2H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | NXVPMDAZXWJJIP-YRXWBPOGSA-N |
| XLogP | 2.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |