C11H19NO3 — CID 102039439
1-(4-methoxy-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl)prop-2-en-1-one (PubChem CID 102039439) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-(4-methoxy-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl)prop-2-en-1-one.
| Compound Name | 1-(4-methoxy-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102039439 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 1-(4-methoxy-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1C(OC)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C11H19NO3/c1-7-8(13)12-9(14-6)10(2,3)15-11(12,4)5/h7,9H,1H2,2-6H3 |
| InChIKey | ZZDFNOJOVDPCQZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|