C16H19NOS — CID 102039450
1-(2,2-dimethyl-3-prop-2-enyl-3H-1,4-benzothiazin-4-yl)prop-2-en-1-one (PubChem CID 102039450) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3-prop-2-enyl-3H-1,4-benzothiazin-4-yl)prop-2-en-1-one.
| Compound Name | 1-(2,2-dimethyl-3-prop-2-enyl-3H-1,4-benzothiazin-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102039450 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-(2,2-dimethyl-3-prop-2-enyl-3H-1,4-benzothiazin-4-yl)prop-2-en-1-one |
| SMILES | C=CCC1N(C(=O)C=C)c2ccccc2SC1(C)C |
| InChI | InChI=1S/C16H19NOS/c1-5-9-14-16(3,4)19-13-11-8-7-10-12(13)17(14)15(18)6-2/h5-8,10-11,14H,1-2,9H2,3-4H3 |
| InChIKey | GXLHTYZIPVGQGF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|