C26H26N4 — CID 102040638
4-[[10-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]anthracen-9-yl]methyl]-3,5-dimethyl-1H-pyrazole (PubChem CID 102040638) has the molecular formula C26H26N4 and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-[[10-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]anthracen-9-yl]methyl]-3,5-dimethyl-1H-pyrazole.
| Compound Name | 4-[[10-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]anthracen-9-yl]methyl]-3,5-dimethyl-1H-pyrazole |
|---|---|
| PubChem CID | 102040638 |
| Molecular Formula | C26H26N4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 4-[[10-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]anthracen-9-yl]methyl]-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1Cc1c2ccccc2c(Cc2c(C)n[nH]c2C)c2ccccc12 |
| InChI | InChI=1S/C26H26N4/c1-15-23(16(2)28-27-15)13-25-19-9-5-7-11-21(19)26(22-12-8-6-10-20(22)25)14-24-17(3)29-30-18(24)4/h5-12H,13-14H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | AQWFVCCFYATZKT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|