C32H30N2O4+2 — CID 102040912
4-[4-[4-[2,5-dimethoxy-4-(1-methylpyridin-1-ium-4-yl)phenyl]buta-1,3-diynyl]-2,5-dimethoxyphenyl]-1-methylpyridin-1-ium (PubChem CID 102040912) has the molecular formula C32H30N2O4+2 and a molecular weight of 506.60 g/mol. Its IUPAC name is 4-[4-[4-[2,5-dimethoxy-4-(1-methylpyridin-1-ium-4-yl)phenyl]buta-1,3-diynyl]-2,5-dimethoxyphenyl]-1-methylpyridin-1-ium.
| Compound Name | 4-[4-[4-[2,5-dimethoxy-4-(1-methylpyridin-1-ium-4-yl)phenyl]buta-1,3-diynyl]-2,5-dimethoxyphenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 102040912 |
| Molecular Formula | C32H30N2O4+2 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 4-[4-[4-[2,5-dimethoxy-4-(1-methylpyridin-1-ium-4-yl)phenyl]buta-1,3-diynyl]-2,5-dimethoxyphenyl]-1-methylpyridin-1-ium |
| SMILES | COc1cc(-c2cc[n+](C)cc2)c(OC)cc1C#CC#Cc1cc(OC)c(-c2cc[n+](C)cc2)cc1OC |
| InChI | InChI=1S/C32H30N2O4/c1-33-15-11-23(12-16-33)27-21-29(35-3)25(19-31(27)37-5)9-7-8-10-26-20-32(38-6)28(22-30(26)36-4)24-13-17-34(2)18-14-24/h11-22H,1-6H3/q+2 |
| InChIKey | OUPLVMUMAIOYHO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|