About 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine
2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine (PubChem CID 102040927) has the molecular formula C27H33N9
and a molecular weight of 483.62 g/mol. Its IUPAC name is 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine.
Molecular Properties
| Compound Name | 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine |
| PubChem CID | 102040927 |
| Molecular Formula | C27H33N9 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine |
| SMILES | Cc1cc(C)n(C(c2cccc(C(n3nc(C)cc3C)n3nc(C)cc3C)n2)n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C27H33N9/c1-16-12-20(5)33(29-16)26(34-21(6)13-17(2)30-34)24-10-9-11-25(28-24)27(35-22(7)14-18(3)31-35)36-23(8)15-19(4)32-36/h9-15,26-27H,1-8H3 |
| InChIKey | OWEVZYXKSIDLIK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine?
The IUPAC name of 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine (CID 102040927) is 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine.
What is the SMILES notation for 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine?
The canonical SMILES for 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine is Cc1cc(C)n(C(c2cccc(C(n3nc(C)cc3C)n3nc(C)cc3C)n2)n2nc(C)cc2C)n1.
What is the InChIKey of 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine?
The InChIKey is OWEVZYXKSIDLIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33N9/c1-16-12-20(5)33(29-16)26(34-21(6)13-17(2)30-34)24-10-9-11-25(28-24)27(35-22(7)14-18(3)31-35)36-23(8)15-19(4)32-36/h9-15,26-27H,1-8H3.
What are the key properties of 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine?
2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine has a molecular weight of 483.62 g/mol, XLogP of 4.53, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine is sourced from PubChem (CID 102040927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).