C45H36N6O2 — CID 102041468
N-(1,10-phenanthrolin-5-yl)-1-[9-[6-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]hexyl]carbazol-3-yl]methanimine (PubChem CID 102041468) has the molecular formula C45H36N6O2 and a molecular weight of 692.82 g/mol. Its IUPAC name is N-(1,10-phenanthrolin-5-yl)-1-[9-[6-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]hexyl]carbazol-3-yl]methanimine.
| Compound Name | N-(1,10-phenanthrolin-5-yl)-1-[9-[6-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]hexyl]carbazol-3-yl]methanimine |
|---|---|
| PubChem CID | 102041468 |
| Molecular Formula | C45H36N6O2 |
| Molecular Weight | 692.82 g/mol |
| Exact Mass | 692.29 |
| IUPAC Name | N-(1,10-phenanthrolin-5-yl)-1-[9-[6-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]hexyl]carbazol-3-yl]methanimine |
| SMILES | C(=N/c1cc2cccnc2c2ncccc12)\c1ccc2c(c1)c1ccccc1n2CCCCCCOc1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C45H36N6O2/c1(2-9-27-52-35-21-19-33(20-22-35)45-50-49-44(53-45)32-12-4-3-5-13-32)8-26-51-40-17-7-6-15-36(40)38-28-31(18-23-41(38)51)30-48-39-29-34-14-10-24-46-42(34)43-37(39)16-11-25-47-43/h3-7,10-25,28-30H,1-2,8-9,26-27H2/b48-30+ |
| InChIKey | NNMOTCFDYUNEJQ-MUEODZSNSA-N |
| XLogP | 11.00 |
| TPSA | 91.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.82 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|