C49H44N6O2 — CID 102041469
1-[9-[6-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]hexyl]carbazol-3-yl]-N-(1,10-phenanthrolin-5-yl)methanimine (PubChem CID 102041469) has the molecular formula C49H44N6O2 and a molecular weight of 748.93 g/mol. Its IUPAC name is 1-[9-[6-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]hexyl]carbazol-3-yl]-N-(1,10-phenanthrolin-5-yl)methanimine.
| Compound Name | 1-[9-[6-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]hexyl]carbazol-3-yl]-N-(1,10-phenanthrolin-5-yl)methanimine |
|---|---|
| PubChem CID | 102041469 |
| Molecular Formula | C49H44N6O2 |
| Molecular Weight | 748.93 g/mol |
| Exact Mass | 748.35 |
| IUPAC Name | 1-[9-[6-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]hexyl]carbazol-3-yl]-N-(1,10-phenanthrolin-5-yl)methanimine |
| SMILES | CC(C)(C)c1ccc(-c2nnc(-c3ccc(OCCCCCCn4c5ccccc5c5cc(/C=N/c6cc7cccnc7c7ncccc67)ccc54)cc3)o2)cc1 |
| InChI | InChI=1S/C49H44N6O2/c1-49(2,3)37-21-17-34(18-22-37)47-53-54-48(57-47)35-19-23-38(24-20-35)56-29-9-5-4-8-28-55-43-15-7-6-13-39(43)41-30-33(16-25-44(41)55)32-52-42-31-36-12-10-26-50-45(36)46-40(42)14-11-27-51-46/h6-7,10-27,30-32H,4-5,8-9,28-29H2,1-3H3/b52-32+ |
| InChIKey | ATOCHXJONNVDIL-MTZGLDRGSA-N |
| XLogP | 12.30 |
| TPSA | 91.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.93 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|