C46H38N6O3 — CID 102041472
1-[9-[6-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]hexyl]carbazol-3-yl]-N-(1,10-phenanthrolin-5-yl)methanimine (PubChem CID 102041472) has the molecular formula C46H38N6O3 and a molecular weight of 722.85 g/mol. Its IUPAC name is 1-[9-[6-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]hexyl]carbazol-3-yl]-N-(1,10-phenanthrolin-5-yl)methanimine.
| Compound Name | 1-[9-[6-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]hexyl]carbazol-3-yl]-N-(1,10-phenanthrolin-5-yl)methanimine |
|---|---|
| PubChem CID | 102041472 |
| Molecular Formula | C46H38N6O3 |
| Molecular Weight | 722.85 g/mol |
| Exact Mass | 722.30 |
| IUPAC Name | 1-[9-[6-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]hexyl]carbazol-3-yl]-N-(1,10-phenanthrolin-5-yl)methanimine |
| SMILES | COc1ccc(-c2nnc(-c3ccc(OCCCCCCn4c5ccccc5c5cc(/C=N/c6cc7cccnc7c7ncccc67)ccc54)cc3)o2)cc1 |
| InChI | InChI=1S/C46H38N6O3/c1-53-35-19-15-32(16-20-35)45-50-51-46(55-45)33-17-21-36(22-18-33)54-27-7-3-2-6-26-52-41-13-5-4-11-37(41)39-28-31(14-23-42(39)52)30-49-40-29-34-10-8-24-47-43(34)44-38(40)12-9-25-48-44/h4-5,8-25,28-30H,2-3,6-7,26-27H2,1H3/b49-30+ |
| InChIKey | LURPZKNALLTZFE-OUFTWPDZSA-N |
| XLogP | 11.01 |
| TPSA | 100.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.85 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|