C38H40N2O6 — CID 102042028
methyl 2-[[4-[(1-methoxy-4-methyl-1-oxopentan-2-yl)carbamoyl]-2,5-bis(2-phenylethynyl)benzoyl]amino]-4-methylpentanoate (PubChem CID 102042028) has the molecular formula C38H40N2O6 and a molecular weight of 620.75 g/mol. Its IUPAC name is methyl 2-[[4-[(1-methoxy-4-methyl-1-oxopentan-2-yl)carbamoyl]-2,5-bis(2-phenylethynyl)benzoyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[4-[(1-methoxy-4-methyl-1-oxopentan-2-yl)carbamoyl]-2,5-bis(2-phenylethynyl)benzoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 102042028 |
| Molecular Formula | C38H40N2O6 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | methyl 2-[[4-[(1-methoxy-4-methyl-1-oxopentan-2-yl)carbamoyl]-2,5-bis(2-phenylethynyl)benzoyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)c1cc(C#Cc2ccccc2)c(C(=O)NC(CC(C)C)C(=O)OC)cc1C#Cc1ccccc1 |
| InChI | InChI=1S/C38H40N2O6/c1-25(2)21-33(37(43)45-5)39-35(41)31-23-30(20-18-28-15-11-8-12-16-28)32(24-29(31)19-17-27-13-9-7-10-14-27)36(42)40-34(22-26(3)4)38(44)46-6/h7-16,23-26,33-34H,21-22H2,1-6H3,(H,39,41)(H,40,42) |
| InChIKey | GKIWTCSTOPYDCU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|