C27H23NO2 — CID 102042104
(4S,4aS,12bS)-4-[(Z)-2-(4-methoxyphenyl)ethenyl]-1,3,4,12b-tetrahydrophenanthro[9,10-c]pyran-4a-carbonitrile (PubChem CID 102042104) has the molecular formula C27H23NO2 and a molecular weight of 393.49 g/mol. Its IUPAC name is (4S,4aS,12bS)-4-[(Z)-2-(4-methoxyphenyl)ethenyl]-1,3,4,12b-tetrahydrophenanthro[9,10-c]pyran-4a-carbonitrile.
| Compound Name | (4S,4aS,12bS)-4-[(Z)-2-(4-methoxyphenyl)ethenyl]-1,3,4,12b-tetrahydrophenanthro[9,10-c]pyran-4a-carbonitrile |
|---|---|
| PubChem CID | 102042104 |
| Molecular Formula | C27H23NO2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (4S,4aS,12bS)-4-[(Z)-2-(4-methoxyphenyl)ethenyl]-1,3,4,12b-tetrahydrophenanthro[9,10-c]pyran-4a-carbonitrile |
| SMILES | COc1ccc(/C=C\[C@@H]2COC[C@H]3c4ccccc4-c4ccccc4[C@]23C#N)cc1 |
| InChI | InChI=1S/C27H23NO2/c1-29-21-14-11-19(12-15-21)10-13-20-16-30-17-26-24-8-3-2-6-22(24)23-7-4-5-9-25(23)27(20,26)18-28/h2-15,20,26H,16-17H2,1H3/b13-10-/t20-,26+,27+/m1/s1 |
| InChIKey | HNJURIQEVPGTMJ-OUSNZZRJSA-N |
| XLogP | 5.58 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |