C22H21ClO6S — CID 102042534
methyl (1R,5R)-5-[2-(benzenesulfonyl)-2-chloro-2-phenylacetyl]oxycyclohex-3-ene-1-carboxylate (PubChem CID 102042534) has the molecular formula C22H21ClO6S and a molecular weight of 448.92 g/mol. Its IUPAC name is methyl (1R,5R)-5-[2-(benzenesulfonyl)-2-chloro-2-phenylacetyl]oxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,5R)-5-[2-(benzenesulfonyl)-2-chloro-2-phenylacetyl]oxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102042534 |
| Molecular Formula | C22H21ClO6S |
| Molecular Weight | 448.92 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | methyl (1R,5R)-5-[2-(benzenesulfonyl)-2-chloro-2-phenylacetyl]oxycyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=C[C@H](OC(=O)C(Cl)(c2ccccc2)S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C22H21ClO6S/c1-28-20(24)16-9-8-12-18(15-16)29-21(25)22(23,17-10-4-2-5-11-17)30(26,27)19-13-6-3-7-14-19/h2-8,10-14,16,18H,9,15H2,1H3/t16-,18+,22?/m1/s1 |
| InChIKey | AEXVURPWDFKXDT-CKYAKLRSSA-N |
| XLogP | 3.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.92 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|