About 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole
2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole (PubChem CID 102043111) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole |
| PubChem CID | 102043111 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole |
| SMILES | CCC/C=C(\CCC)c1nc2ccccc2o1 |
| InChI | InChI=1S/C15H19NO/c1-3-5-9-12(8-4-2)15-16-13-10-6-7-11-14(13)17-15/h6-7,9-11H,3-5,8H2,1-2H3/b12-9+ |
| InChIKey | CDXCFOUPPSZWCY-FMIVXFBMSA-N |
| XLogP | 4.81 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole?
The IUPAC name of 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole (CID 102043111) is 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole.
What is the SMILES notation for 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole?
The canonical SMILES for 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole is CCC/C=C(\CCC)c1nc2ccccc2o1.
What is the InChIKey of 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole?
The InChIKey is CDXCFOUPPSZWCY-FMIVXFBMSA-N. The full InChI is InChI=1S/C15H19NO/c1-3-5-9-12(8-4-2)15-16-13-10-6-7-11-14(13)17-15/h6-7,9-11H,3-5,8H2,1-2H3/b12-9+.
What are the key properties of 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole?
2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole has a molecular weight of 229.32 g/mol, XLogP of 4.81, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole is sourced from PubChem (CID 102043111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).