C15H19NO — CID 102043111
2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole (PubChem CID 102043111) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole.
| Compound Name | 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 102043111 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-[(E)-oct-4-en-4-yl]-1,3-benzoxazole |
| SMILES | CCC/C=C(\CCC)c1nc2ccccc2o1 |
| InChI | InChI=1S/C15H19NO/c1-3-5-9-12(8-4-2)15-16-13-10-6-7-11-14(13)17-15/h6-7,9-11H,3-5,8H2,1-2H3/b12-9+ |
| InChIKey | CDXCFOUPPSZWCY-FMIVXFBMSA-N |
| XLogP | 4.81 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |