About 7-(2-methyl-1,3-dioxolan-2-yl)heptanal
7-(2-methyl-1,3-dioxolan-2-yl)heptanal (PubChem CID 102043190) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 7-(2-methyl-1,3-dioxolan-2-yl)heptanal.
Molecular Properties
| Compound Name | 7-(2-methyl-1,3-dioxolan-2-yl)heptanal |
| PubChem CID | 102043190 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 7-(2-methyl-1,3-dioxolan-2-yl)heptanal |
| SMILES | CC1(CCCCCCC=O)OCCO1 |
| InChI | InChI=1S/C11H20O3/c1-11(13-9-10-14-11)7-5-3-2-4-6-8-12/h8H,2-7,9-10H2,1H3 |
| InChIKey | VAAVAGUVCTXJIQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(2-methyl-1,3-dioxolan-2-yl)heptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-methyl-1,3-dioxolan-2-yl)heptanal?
The IUPAC name of 7-(2-methyl-1,3-dioxolan-2-yl)heptanal (CID 102043190) is 7-(2-methyl-1,3-dioxolan-2-yl)heptanal.
What is the SMILES notation for 7-(2-methyl-1,3-dioxolan-2-yl)heptanal?
The canonical SMILES for 7-(2-methyl-1,3-dioxolan-2-yl)heptanal is CC1(CCCCCCC=O)OCCO1.
What is the InChIKey of 7-(2-methyl-1,3-dioxolan-2-yl)heptanal?
The InChIKey is VAAVAGUVCTXJIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-11(13-9-10-14-11)7-5-3-2-4-6-8-12/h8H,2-7,9-10H2,1H3.
What are the key properties of 7-(2-methyl-1,3-dioxolan-2-yl)heptanal?
7-(2-methyl-1,3-dioxolan-2-yl)heptanal has a molecular weight of 200.28 g/mol, XLogP of 2.29, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-methyl-1,3-dioxolan-2-yl)heptanal is sourced from PubChem (CID 102043190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).