About (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one
(5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one (PubChem CID 102043509) has the molecular formula C14H12F3NO2
and a molecular weight of 283.25 g/mol. Its IUPAC name is (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one |
| PubChem CID | 102043509 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one |
| SMILES | O=C1CC/C(=C\C(=O)C(F)(F)F)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H12F3NO2/c15-14(16,17)12(19)8-11-6-7-13(20)18(11)9-10-4-2-1-3-5-10/h1-5,8H,6-7,9H2/b11-8+ |
| InChIKey | XXTZSZJLHDVHJG-DHZHZOJOSA-N |
| XLogP | 2.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one?
The IUPAC name of (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one (CID 102043509) is (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one.
What is the SMILES notation for (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one?
The canonical SMILES for (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one is O=C1CC/C(=C\C(=O)C(F)(F)F)N1Cc1ccccc1.
What is the InChIKey of (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one?
The InChIKey is XXTZSZJLHDVHJG-DHZHZOJOSA-N. The full InChI is InChI=1S/C14H12F3NO2/c15-14(16,17)12(19)8-11-6-7-13(20)18(11)9-10-4-2-1-3-5-10/h1-5,8H,6-7,9H2/b11-8+.
What are the key properties of (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one?
(5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one has a molecular weight of 283.25 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-1-benzyl-5-(3,3,3-trifluoro-2-oxopropylidene)pyrrolidin-2-one is sourced from PubChem (CID 102043509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).