C26H29N3O6 — CID 102043608
(1'S,2S,3'S,7'R,8'R)-7'-hydroxy-4',4',7,7-tetramethylspiro[1H-pyrano[2,3-g]indole-2,5'-6-oxa-10,15-diazatetracyclo[6.5.2.01,10.03,8]pentadecane]-3,9',14'-trione (PubChem CID 102043608) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is (1'S,2S,3'S,7'R,8'R)-7'-hydroxy-4',4',7,7-tetramethylspiro[1H-pyrano[2,3-g]indole-2,5'-6-oxa-10,15-diazatetracyclo[6.5.2.01,10.03,8]pentadecane]-3,9',14'-trione.
| Compound Name | (1'S,2S,3'S,7'R,8'R)-7'-hydroxy-4',4',7,7-tetramethylspiro[1H-pyrano[2,3-g]indole-2,5'-6-oxa-10,15-diazatetracyclo[6.5.2.01,10.03,8]pentadecane]-3,9',14'-trione |
|---|---|
| PubChem CID | 102043608 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (1'S,2S,3'S,7'R,8'R)-7'-hydroxy-4',4',7,7-tetramethylspiro[1H-pyrano[2,3-g]indole-2,5'-6-oxa-10,15-diazatetracyclo[6.5.2.01,10.03,8]pentadecane]-3,9',14'-trione |
| SMILES | CC1(C)C=Cc2c(ccc3c2N[C@@]2(O[C@@H](O)[C@@]45NC(=O)[C@]6(CCCN6C4=O)C[C@H]5C2(C)C)C3=O)O1 |
| InChI | InChI=1S/C26H29N3O6/c1-22(2)10-8-13-15(34-22)7-6-14-17(13)27-26(18(14)30)23(3,4)16-12-24-9-5-11-29(24)20(32)25(16,21(33)35-26)28-19(24)31/h6-8,10,16,21,27,33H,5,9,11-12H2,1-4H3,(H,28,31)/t16-,21+,24-,25-,26+/m0/s1 |
| InChIKey | ZPXKISNDQRGXBE-OJUKFVNASA-N |
| XLogP | 1.80 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |