C24H34O7 — CID 102043810
[(E,2S)-7-[(2R,5S,6S)-5-(methoxymethoxy)-6-(2-methoxy-2-oxoethyl)oxan-2-yl]hept-6-en-2-yl] benzoate (PubChem CID 102043810) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is [(E,2S)-7-[(2R,5S,6S)-5-(methoxymethoxy)-6-(2-methoxy-2-oxoethyl)oxan-2-yl]hept-6-en-2-yl] benzoate.
| Compound Name | [(E,2S)-7-[(2R,5S,6S)-5-(methoxymethoxy)-6-(2-methoxy-2-oxoethyl)oxan-2-yl]hept-6-en-2-yl] benzoate |
|---|---|
| PubChem CID | 102043810 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(E,2S)-7-[(2R,5S,6S)-5-(methoxymethoxy)-6-(2-methoxy-2-oxoethyl)oxan-2-yl]hept-6-en-2-yl] benzoate |
| SMILES | COCO[C@H]1CC[C@H](/C=C/CCC[C@H](C)OC(=O)c2ccccc2)O[C@H]1CC(=O)OC |
| InChI | InChI=1S/C24H34O7/c1-18(30-24(26)19-11-7-5-8-12-19)10-6-4-9-13-20-14-15-21(29-17-27-2)22(31-20)16-23(25)28-3/h5,7-9,11-13,18,20-22H,4,6,10,14-17H2,1-3H3/b13-9+/t18-,20-,21-,22-/m0/s1 |
| InChIKey | RPOIPKOORYCPSA-NTIOWWDKSA-N |
| XLogP | 4.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|