C9H16O6 — CID 102044235
(2S,3R,4S,5S)-2-(hydroxymethyl)-2-prop-2-enoxyoxane-3,4,5-triol (PubChem CID 102044235) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-(hydroxymethyl)-2-prop-2-enoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-(hydroxymethyl)-2-prop-2-enoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 102044235 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (2S,3R,4S,5S)-2-(hydroxymethyl)-2-prop-2-enoxyoxane-3,4,5-triol |
| SMILES | C=CCO[C@@]1(CO)OC[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O6/c1-2-3-14-9(5-10)8(13)7(12)6(11)4-15-9/h2,6-8,10-13H,1,3-5H2/t6-,7-,8+,9-/m0/s1 |
| InChIKey | LMBGMRFQWPWGPK-MAUMQABQSA-N |
| XLogP | -2.01 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|