C22H23NO2S — CID 102044605
(5S,10S)-7-benzyl-10-(1-thiophen-2-ylethenyl)-7-azaspiro[4.5]decane-4,6-dione (PubChem CID 102044605) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is (5S,10S)-7-benzyl-10-(1-thiophen-2-ylethenyl)-7-azaspiro[4.5]decane-4,6-dione.
| Compound Name | (5S,10S)-7-benzyl-10-(1-thiophen-2-ylethenyl)-7-azaspiro[4.5]decane-4,6-dione |
|---|---|
| PubChem CID | 102044605 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (5S,10S)-7-benzyl-10-(1-thiophen-2-ylethenyl)-7-azaspiro[4.5]decane-4,6-dione |
| SMILES | C=C(c1cccs1)[C@H]1CCN(Cc2ccccc2)C(=O)[C@@]12CCCC2=O |
| InChI | InChI=1S/C22H23NO2S/c1-16(19-9-6-14-26-19)18-11-13-23(15-17-7-3-2-4-8-17)21(25)22(18)12-5-10-20(22)24/h2-4,6-9,14,18H,1,5,10-13,15H2/t18-,22+/m1/s1 |
| InChIKey | DOZMNKRNPYYZCI-GCJKJVERSA-N |
| XLogP | 4.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|