C14H20O2 — CID 102044631
(3aR,3bR,5R,6aR,7aR)-5-methoxy-7,7-dimethyl-3b,4,5,6,6a,7a-hexahydro-3aH-cyclopenta[a]pentalen-1-one (PubChem CID 102044631) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (3aR,3bR,5R,6aR,7aR)-5-methoxy-7,7-dimethyl-3b,4,5,6,6a,7a-hexahydro-3aH-cyclopenta[a]pentalen-1-one.
| Compound Name | (3aR,3bR,5R,6aR,7aR)-5-methoxy-7,7-dimethyl-3b,4,5,6,6a,7a-hexahydro-3aH-cyclopenta[a]pentalen-1-one |
|---|---|
| PubChem CID | 102044631 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (3aR,3bR,5R,6aR,7aR)-5-methoxy-7,7-dimethyl-3b,4,5,6,6a,7a-hexahydro-3aH-cyclopenta[a]pentalen-1-one |
| SMILES | CO[C@@H]1C[C@@H]2[C@H]3C=CC(=O)[C@H]3C(C)(C)[C@@H]2C1 |
| InChI | InChI=1S/C14H20O2/c1-14(2)11-7-8(16-3)6-10(11)9-4-5-12(15)13(9)14/h4-5,8-11,13H,6-7H2,1-3H3/t8-,9-,10-,11-,13+/m1/s1 |
| InChIKey | WLFSZQHQFIXPCB-CJJWORHMSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |