C14H20O2 — CID 102044633
1-[(3aR,5R,6aR)-5-methoxy-1,1-dimethyl-4,5,6,6a-tetrahydro-3aH-pentalen-2-yl]prop-2-en-1-one (PubChem CID 102044633) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-[(3aR,5R,6aR)-5-methoxy-1,1-dimethyl-4,5,6,6a-tetrahydro-3aH-pentalen-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(3aR,5R,6aR)-5-methoxy-1,1-dimethyl-4,5,6,6a-tetrahydro-3aH-pentalen-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 102044633 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-[(3aR,5R,6aR)-5-methoxy-1,1-dimethyl-4,5,6,6a-tetrahydro-3aH-pentalen-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)C1=C[C@H]2C[C@@H](OC)C[C@H]2C1(C)C |
| InChI | InChI=1S/C14H20O2/c1-5-13(15)12-7-9-6-10(16-4)8-11(9)14(12,2)3/h5,7,9-11H,1,6,8H2,2-4H3/t9-,10-,11-/m1/s1 |
| InChIKey | NAXYAFHZCQLDHQ-GMTAPVOTSA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|