About 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene
5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene (PubChem CID 102045276) has the molecular formula C25H32O6
and a molecular weight of 428.53 g/mol. Its IUPAC name is 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene.
Molecular Properties
| Compound Name | 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene |
| PubChem CID | 102045276 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene |
| SMILES | COCOc1cc(C(=C2CCCCC2)c2cc(OC)c(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C25H32O6/c1-26-16-31-21-13-18(11-12-20(21)27-2)24(17-9-7-6-8-10-17)19-14-22(28-3)25(30-5)23(15-19)29-4/h11-15H,6-10,16H2,1-5H3 |
| InChIKey | IRPWEUIAUKLZQJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene?
The IUPAC name of 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene (CID 102045276) is 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene.
What is the SMILES notation for 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene?
The canonical SMILES for 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene is COCOc1cc(C(=C2CCCCC2)c2cc(OC)c(OC)c(OC)c2)ccc1OC.
What is the InChIKey of 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene?
The InChIKey is IRPWEUIAUKLZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32O6/c1-26-16-31-21-13-18(11-12-20(21)27-2)24(17-9-7-6-8-10-17)19-14-22(28-3)25(30-5)23(15-19)29-4/h11-15H,6-10,16H2,1-5H3.
What are the key properties of 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene?
5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene has a molecular weight of 428.53 g/mol, XLogP of 5.47, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene is sourced from PubChem (CID 102045276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).