C25H32O6 — CID 102045276
5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene (PubChem CID 102045276) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 102045276 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 5-[cyclohexylidene-[4-methoxy-3-(methoxymethoxy)phenyl]methyl]-1,2,3-trimethoxybenzene |
| SMILES | COCOc1cc(C(=C2CCCCC2)c2cc(OC)c(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C25H32O6/c1-26-16-31-21-13-18(11-12-20(21)27-2)24(17-9-7-6-8-10-17)19-14-22(28-3)25(30-5)23(15-19)29-4/h11-15H,6-10,16H2,1-5H3 |
| InChIKey | IRPWEUIAUKLZQJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|