C13H11Br2FO2 — CID 102045662
ethyl (E)-3-[2-(2,2-dibromoethenyl)-5-fluorophenyl]prop-2-enoate (PubChem CID 102045662) has the molecular formula C13H11Br2FO2 and a molecular weight of 378.04 g/mol. Its IUPAC name is ethyl (E)-3-[2-(2,2-dibromoethenyl)-5-fluorophenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-(2,2-dibromoethenyl)-5-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 102045662 |
| Molecular Formula | C13H11Br2FO2 |
| Molecular Weight | 378.04 g/mol |
| Exact Mass | 375.91 |
| IUPAC Name | ethyl (E)-3-[2-(2,2-dibromoethenyl)-5-fluorophenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(F)ccc1C=C(Br)Br |
| InChI | InChI=1S/C13H11Br2FO2/c1-2-18-13(17)6-4-9-7-11(16)5-3-10(9)8-12(14)15/h3-8H,2H2,1H3/b6-4+ |
| InChIKey | IFJNKFWBHSCHTH-GQCTYLIASA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.04 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|