C29H58O6Si2 — CID 102045925
ethyl (6E,8S,9R,10R,11E)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-8-methoxy-12-methyltrideca-6,11-dienoate (PubChem CID 102045925) has the molecular formula C29H58O6Si2 and a molecular weight of 558.95 g/mol. Its IUPAC name is ethyl (6E,8S,9R,10R,11E)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-8-methoxy-12-methyltrideca-6,11-dienoate.
| Compound Name | ethyl (6E,8S,9R,10R,11E)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-8-methoxy-12-methyltrideca-6,11-dienoate |
|---|---|
| PubChem CID | 102045925 |
| Molecular Formula | C29H58O6Si2 |
| Molecular Weight | 558.95 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | ethyl (6E,8S,9R,10R,11E)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-8-methoxy-12-methyltrideca-6,11-dienoate |
| SMILES | CCOC(=O)CCCC/C=C/[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C(\C)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H58O6Si2/c1-14-33-26(31)20-18-16-15-17-19-24(32-9)27(35-37(12,13)29(6,7)8)25(21-23(2)22-30)34-36(10,11)28(3,4)5/h17,19,21,24-25,27,30H,14-16,18,20,22H2,1-13H3/b19-17+,23-21+/t24-,25+,27+/m0/s1 |
| InChIKey | TXFYYVCOFAILLY-BFJKNSIZSA-N |
| XLogP | 7.40 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.95 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|