C19H42O4Si2 — CID 102045926
(2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyhex-5-en-1-ol (PubChem CID 102045926) has the molecular formula C19H42O4Si2 and a molecular weight of 390.71 g/mol. Its IUPAC name is (2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyhex-5-en-1-ol.
| Compound Name | (2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyhex-5-en-1-ol |
|---|---|
| PubChem CID | 102045926 |
| Molecular Formula | C19H42O4Si2 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyhex-5-en-1-ol |
| SMILES | C=C[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H42O4Si2/c1-13-15(21-8)17(23-25(11,12)19(5,6)7)16(14-20)22-24(9,10)18(2,3)4/h13,15-17,20H,1,14H2,2-12H3/t15-,16+,17+/m0/s1 |
| InChIKey | TUHYJPONEMUBNE-GVDBMIGSSA-N |
| XLogP | 4.96 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|