C22H22F6N4 — CID 10204603
7-[2,4-bis(trifluoromethyl)phenyl]-10-methyl-2-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene (PubChem CID 10204603) has the molecular formula C22H22F6N4 and a molecular weight of 456.43 g/mol. Its IUPAC name is 7-[2,4-bis(trifluoromethyl)phenyl]-10-methyl-2-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene.
| Compound Name | 7-[2,4-bis(trifluoromethyl)phenyl]-10-methyl-2-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene |
|---|---|
| PubChem CID | 10204603 |
| Molecular Formula | C22H22F6N4 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 7-[2,4-bis(trifluoromethyl)phenyl]-10-methyl-2-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene |
| SMILES | CCC(CC)n1cc2c3c(nc(C)nc31)N(c1ccc(C(F)(F)F)cc1C(F)(F)F)CC2 |
| InChI | InChI=1S/C22H22F6N4/c1-4-15(5-2)32-11-13-8-9-31(19-18(13)20(32)30-12(3)29-19)17-7-6-14(21(23,24)25)10-16(17)22(26,27)28/h6-7,10-11,15H,4-5,8-9H2,1-3H3 |
| InChIKey | SLHQCRXWSATTKO-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |