C26H18N8O6 — CID 102046044
1-benzoyl-4-[[4-[(1-benzoyl-3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]diazenyl]pyrazolidine-3,5-dione (PubChem CID 102046044) has the molecular formula C26H18N8O6 and a molecular weight of 538.48 g/mol. Its IUPAC name is 1-benzoyl-4-[[4-[(1-benzoyl-3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]diazenyl]pyrazolidine-3,5-dione.
| Compound Name | 1-benzoyl-4-[[4-[(1-benzoyl-3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]diazenyl]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 102046044 |
| Molecular Formula | C26H18N8O6 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 1-benzoyl-4-[[4-[(1-benzoyl-3,5-dioxopyrazolidin-4-yl)diazenyl]phenyl]diazenyl]pyrazolidine-3,5-dione |
| SMILES | O=C1NN(C(=O)c2ccccc2)C(=O)C1/N=N/c1ccc(/N=N/C2C(=O)NN(C(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H18N8O6/c35-21-19(25(39)33(31-21)23(37)15-7-3-1-4-8-15)29-27-17-11-13-18(14-12-17)28-30-20-22(36)32-34(26(20)40)24(38)16-9-5-2-6-10-16/h1-14,19-20H,(H,31,35)(H,32,36)/b29-27+,30-28+ |
| InChIKey | OZJUFTJBTYRRJE-QAVVBOBSSA-N |
| XLogP | 2.02 |
| TPSA | 182.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|