C19H40O8Si3 — CID 102046288
[(2R,3S,4S,5R)-6-acetyloxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl acetate (PubChem CID 102046288) has the molecular formula C19H40O8Si3 and a molecular weight of 480.78 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-6-acetyloxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-6-acetyloxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102046288 |
| Molecular Formula | C19H40O8Si3 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | [(2R,3S,4S,5R)-6-acetyloxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC(C)=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C19H40O8Si3/c1-13(20)22-12-15-16(25-28(3,4)5)17(26-29(6,7)8)18(27-30(9,10)11)19(24-15)23-14(2)21/h15-19H,12H2,1-11H3/t15-,16+,17+,18-,19?/m1/s1 |
| InChIKey | DFLPDXRXNBIFSA-YVTHPHIOSA-N |
| XLogP | 3.50 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|