C44H68B2O6 — CID 102046739
2-[9-(2-ethylhexyl)-9-[6-(oxan-2-yloxy)hexyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102046739) has the molecular formula C44H68B2O6 and a molecular weight of 714.65 g/mol. Its IUPAC name is 2-[9-(2-ethylhexyl)-9-[6-(oxan-2-yloxy)hexyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9-(2-ethylhexyl)-9-[6-(oxan-2-yloxy)hexyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102046739 |
| Molecular Formula | C44H68B2O6 |
| Molecular Weight | 714.65 g/mol |
| Exact Mass | 714.52 |
| IUPAC Name | 2-[9-(2-ethylhexyl)-9-[6-(oxan-2-yloxy)hexyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCC(CC)CC1(CCCCCCOC2CCCCO2)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C44H68B2O6/c1-11-13-20-32(12-2)31-44(26-17-14-15-18-27-47-39-21-16-19-28-48-39)37-29-33(45-49-40(3,4)41(5,6)50-45)22-24-35(37)36-25-23-34(30-38(36)44)46-51-42(7,8)43(9,10)52-46/h22-25,29-30,32,39H,11-21,26-28,31H2,1-10H3 |
| InChIKey | GLTVSGUAGBSYKZ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.65 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|