C27H29NO4Si — CID 102046794
(4S)-3-[(2S,3S)-2-[[dimethyl(phenyl)silyl]methyl]-3-hydroxy-3-phenylpropanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 102046794) has the molecular formula C27H29NO4Si and a molecular weight of 459.62 g/mol. Its IUPAC name is (4S)-3-[(2S,3S)-2-[[dimethyl(phenyl)silyl]methyl]-3-hydroxy-3-phenylpropanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S,3S)-2-[[dimethyl(phenyl)silyl]methyl]-3-hydroxy-3-phenylpropanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102046794 |
| Molecular Formula | C27H29NO4Si |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (4S)-3-[(2S,3S)-2-[[dimethyl(phenyl)silyl]methyl]-3-hydroxy-3-phenylpropanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C[C@H](C(=O)N1C(=O)OC[C@@H]1c1ccccc1)[C@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO4Si/c1-33(2,22-16-10-5-11-17-22)19-23(25(29)21-14-8-4-9-15-21)26(30)28-24(18-32-27(28)31)20-12-6-3-7-13-20/h3-17,23-25,29H,18-19H2,1-2H3/t23-,24+,25+/m0/s1 |
| InChIKey | UFZNZTIYAIHZTE-ISJGIBHGSA-N |
| XLogP | 4.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|