C14H20O3 — CID 102046857
methyl (1S,6S)-5-methylidene-11-oxobicyclo[4.4.1]undecane-1-carboxylate (PubChem CID 102046857) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl (1S,6S)-5-methylidene-11-oxobicyclo[4.4.1]undecane-1-carboxylate.
| Compound Name | methyl (1S,6S)-5-methylidene-11-oxobicyclo[4.4.1]undecane-1-carboxylate |
|---|---|
| PubChem CID | 102046857 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | methyl (1S,6S)-5-methylidene-11-oxobicyclo[4.4.1]undecane-1-carboxylate |
| SMILES | C=C1CCC[C@@]2(C(=O)OC)CCCC[C@@H]1C2=O |
| InChI | InChI=1S/C14H20O3/c1-10-6-5-9-14(13(16)17-2)8-4-3-7-11(10)12(14)15/h11H,1,3-9H2,2H3/t11-,14-/m0/s1 |
| InChIKey | JFBDHYKSMZDWSP-FZMZJTMJSA-N |
| XLogP | 2.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|