C26H38O2Si2 — CID 102047180
[propan-2-yl-(2,4,6-trimethylbenzoyl)-trimethylsilylsilyl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 102047180) has the molecular formula C26H38O2Si2 and a molecular weight of 438.76 g/mol. Its IUPAC name is [propan-2-yl-(2,4,6-trimethylbenzoyl)-trimethylsilylsilyl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [propan-2-yl-(2,4,6-trimethylbenzoyl)-trimethylsilylsilyl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 102047180 |
| Molecular Formula | C26H38O2Si2 |
| Molecular Weight | 438.76 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | [propan-2-yl-(2,4,6-trimethylbenzoyl)-trimethylsilylsilyl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)[Si](C(=O)c2c(C)cc(C)cc2C)(C(C)C)[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C26H38O2Si2/c1-16(2)30(29(9,10)11,25(27)23-19(5)12-17(3)13-20(23)6)26(28)24-21(7)14-18(4)15-22(24)8/h12-16H,1-11H3 |
| InChIKey | MHTSPSKPABLMHW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.76 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|