C18H13FS10 — CID 102047359
2-[5-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-5-fluoro-1,3-benzodithiole (PubChem CID 102047359) has the molecular formula C18H13FS10 and a molecular weight of 568.97 g/mol. Its IUPAC name is 2-[5-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-5-fluoro-1,3-benzodithiole.
| Compound Name | 2-[5-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-5-fluoro-1,3-benzodithiole |
|---|---|
| PubChem CID | 102047359 |
| Molecular Formula | C18H13FS10 |
| Molecular Weight | 568.97 g/mol |
| Exact Mass | 567.82 |
| IUPAC Name | 2-[5-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-5-fluoro-1,3-benzodithiole |
| SMILES | CCSC1=C(SCC)SC(=C2SC3=C(S2)SC(=C2Sc4ccc(F)cc4S2)S3)S1 |
| InChI | InChI=1S/C18H13FS10/c1-3-20-11-12(21-4-2)25-15(24-11)16-28-17-18(29-16)27-14(26-17)13-22-9-6-5-8(19)7-10(9)23-13/h5-7H,3-4H2,1-2H3 |
| InChIKey | FBSWMDXSWLHGJB-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.97 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |