About CID 102048360
CID 102048360 (PubChem CID 102048360) has the molecular formula C38H33Cl2N3O3S2
and a molecular weight of 714.74 g/mol.
Molecular Properties
| Compound Name | CID 102048360 |
| PubChem CID | 102048360 |
| Molecular Formula | C38H33Cl2N3O3S2 |
| Molecular Weight | 714.74 g/mol |
| Exact Mass | 713.13 |
| IUPAC Name | — |
| SMILES | CSc1ccc([C@H]2C(c3c(Cl)cccc3Cl)=NO[C@]23CC[C@]2(C3=O)[C@H](c3ccc(SC)cc3)CN(C)[C@@]23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C38H33Cl2N3O3S2/c1-43-21-27(22-11-15-24(47-2)16-12-22)36(38(43)26-7-4-5-10-30(26)41-35(38)45)19-20-37(34(36)44)32(23-13-17-25(48-3)18-14-23)33(42-46-37)31-28(39)8-6-9-29(31)40/h4-18,27,32H,19-21H2,1-3H3,(H,41,45)/t27-,32-,36+,37+,38-/m0/s1 |
| InChIKey | FFGCVXITOGUDER-QYNJMXOISA-N |
| XLogP | 8.62 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 714.74 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 102048360 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102048360?
The IUPAC name of CID 102048360 (CID 102048360) is not available.
What is the SMILES notation for CID 102048360?
The canonical SMILES for CID 102048360 is CSc1ccc([C@H]2C(c3c(Cl)cccc3Cl)=NO[C@]23CC[C@]2(C3=O)[C@H](c3ccc(SC)cc3)CN(C)[C@@]23C(=O)Nc2ccccc23)cc1.
What is the InChIKey of CID 102048360?
The InChIKey is FFGCVXITOGUDER-QYNJMXOISA-N. The full InChI is InChI=1S/C38H33Cl2N3O3S2/c1-43-21-27(22-11-15-24(47-2)16-12-22)36(38(43)26-7-4-5-10-30(26)41-35(38)45)19-20-37(34(36)44)32(23-13-17-25(48-3)18-14-23)33(42-46-37)31-28(39)8-6-9-29(31)40/h4-18,27,32H,19-21H2,1-3H3,(H,41,45)/t27-,32-,36+,37+,38-/m0/s1.
What are the key properties of CID 102048360?
CID 102048360 has a molecular weight of 714.74 g/mol, XLogP of 8.62, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102048360 is sourced from PubChem (CID 102048360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).