C26H27F3O4 — CID 10204841
(Z)-3-[7-[2-(2,2-difluoroethoxy)-3,5-di(propan-2-yl)phenyl]-1-benzofuran-2-yl]-2-fluorobut-2-enoic acid (PubChem CID 10204841) has the molecular formula C26H27F3O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is (Z)-3-[7-[2-(2,2-difluoroethoxy)-3,5-di(propan-2-yl)phenyl]-1-benzofuran-2-yl]-2-fluorobut-2-enoic acid.
| Compound Name | (Z)-3-[7-[2-(2,2-difluoroethoxy)-3,5-di(propan-2-yl)phenyl]-1-benzofuran-2-yl]-2-fluorobut-2-enoic acid |
|---|---|
| PubChem CID | 10204841 |
| Molecular Formula | C26H27F3O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (Z)-3-[7-[2-(2,2-difluoroethoxy)-3,5-di(propan-2-yl)phenyl]-1-benzofuran-2-yl]-2-fluorobut-2-enoic acid |
| SMILES | C/C(=C(/F)C(=O)O)c1cc2cccc(-c3cc(C(C)C)cc(C(C)C)c3OCC(F)F)c2o1 |
| InChI | InChI=1S/C26H27F3O4/c1-13(2)17-9-19(14(3)4)25(32-12-22(27)28)20(10-17)18-8-6-7-16-11-21(33-24(16)18)15(5)23(29)26(30)31/h6-11,13-14,22H,12H2,1-5H3,(H,30,31)/b23-15- |
| InChIKey | XBEQADTVYAUNQN-HAHDFKILSA-N |
| XLogP | 7.78 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|