C23H30O5 — CID 102048463
6-[(1E,3E,5E,7E,9E,11S,12S,13S,14S)-12,14-dihydroxy-11,13-dimethylpentadeca-1,3,5,7,9-pentaenyl]-4-hydroxy-3-methylpyran-2-one (PubChem CID 102048463) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 6-[(1E,3E,5E,7E,9E,11S,12S,13S,14S)-12,14-dihydroxy-11,13-dimethylpentadeca-1,3,5,7,9-pentaenyl]-4-hydroxy-3-methylpyran-2-one.
| Compound Name | 6-[(1E,3E,5E,7E,9E,11S,12S,13S,14S)-12,14-dihydroxy-11,13-dimethylpentadeca-1,3,5,7,9-pentaenyl]-4-hydroxy-3-methylpyran-2-one |
|---|---|
| PubChem CID | 102048463 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 6-[(1E,3E,5E,7E,9E,11S,12S,13S,14S)-12,14-dihydroxy-11,13-dimethylpentadeca-1,3,5,7,9-pentaenyl]-4-hydroxy-3-methylpyran-2-one |
| SMILES | Cc1c(O)cc(/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@H](C)O)oc1=O |
| InChI | InChI=1S/C23H30O5/c1-16(22(26)17(2)19(4)24)13-11-9-7-5-6-8-10-12-14-20-15-21(25)18(3)23(27)28-20/h5-17,19,22,24-26H,1-4H3/b6-5+,9-7+,10-8+,13-11+,14-12+/t16-,17-,19-,22-/m0/s1 |
| InChIKey | BIMAHAXTQWUXRI-GZJSIMIESA-N |
| XLogP | 3.91 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|