C22H20N2O — CID 102048757
(3R)-3,5-diphenyl-2-[(1R)-1-phenylethyl]-3H-1,2,4-oxadiazole (PubChem CID 102048757) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (3R)-3,5-diphenyl-2-[(1R)-1-phenylethyl]-3H-1,2,4-oxadiazole.
| Compound Name | (3R)-3,5-diphenyl-2-[(1R)-1-phenylethyl]-3H-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 102048757 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (3R)-3,5-diphenyl-2-[(1R)-1-phenylethyl]-3H-1,2,4-oxadiazole |
| SMILES | C[C@H](c1ccccc1)N1OC(c2ccccc2)=N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H20N2O/c1-17(18-11-5-2-6-12-18)24-21(19-13-7-3-8-14-19)23-22(25-24)20-15-9-4-10-16-20/h2-17,21H,1H3/t17-,21-/m1/s1 |
| InChIKey | MJFLFKDWMPFPBX-DYESRHJHSA-N |
| XLogP | 5.14 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |