C27H31N3O4 — CID 10204911
4-[[(5-methyl-1,2-oxazol-3-yl)methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]amino]benzoic acid (PubChem CID 10204911) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 4-[[(5-methyl-1,2-oxazol-3-yl)methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]amino]benzoic acid.
| Compound Name | 4-[[(5-methyl-1,2-oxazol-3-yl)methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10204911 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 4-[[(5-methyl-1,2-oxazol-3-yl)methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]amino]benzoic acid |
| SMILES | Cc1cc(CN(C(=O)Nc2ccc(C(=O)O)cc2)c2ccc3c(c2)C(C)(C)CCC3(C)C)no1 |
| InChI | InChI=1S/C27H31N3O4/c1-17-14-20(29-34-17)16-30(25(33)28-19-8-6-18(7-9-19)24(31)32)21-10-11-22-23(15-21)27(4,5)13-12-26(22,2)3/h6-11,14-15H,12-13,16H2,1-5H3,(H,28,33)(H,31,32) |
| InChIKey | JOAXJLPFJXJRGQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |