About CID 102049167
CID 102049167 (PubChem CID 102049167) has the molecular formula C28H38NO2
and a molecular weight of 420.62 g/mol.
Molecular Properties
| Compound Name | CID 102049167 |
| PubChem CID | 102049167 |
| Molecular Formula | C28H38NO2 |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(/C=C/c2ccc3c(c2)C(C)(C)N([O])C3(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H38NO2/c1-25(2,3)22-16-19(17-23(24(22)30)26(4,5)6)12-11-18-13-14-20-21(15-18)28(9,10)29(31)27(20,7)8/h11-17,30H,1-10H3/b12-11+ |
| InChIKey | UQWBLVLGVRLHAE-VAWYXSNFSA-N |
| XLogP | 7.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 102049167 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102049167?
The IUPAC name of CID 102049167 (CID 102049167) is not available.
What is the SMILES notation for CID 102049167?
The canonical SMILES for CID 102049167 is CC(C)(C)c1cc(/C=C/c2ccc3c(c2)C(C)(C)N([O])C3(C)C)cc(C(C)(C)C)c1O.
What is the InChIKey of CID 102049167?
The InChIKey is UQWBLVLGVRLHAE-VAWYXSNFSA-N. The full InChI is InChI=1S/C28H38NO2/c1-25(2,3)22-16-19(17-23(24(22)30)26(4,5)6)12-11-18-13-14-20-21(15-18)28(9,10)29(31)27(20,7)8/h11-17,30H,1-10H3/b12-11+.
What are the key properties of CID 102049167?
CID 102049167 has a molecular weight of 420.62 g/mol, XLogP of 7.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102049167 is sourced from PubChem (CID 102049167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).