About 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone
1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone (PubChem CID 1020492) has the molecular formula C27H24N2O2
and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone |
| PubChem CID | 1020492 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone |
| SMILES | COc1ccc(C(=O)C(c2c(C)[nH]c3ccccc23)c2c(C)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H24N2O2/c1-16-24(20-8-4-6-10-22(20)28-16)26(27(30)18-12-14-19(31-3)15-13-18)25-17(2)29-23-11-7-5-9-21(23)25/h4-15,26,28-29H,1-3H3 |
| InChIKey | WBAWIHWZGDXMQN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone?
The IUPAC name of 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone (CID 1020492) is 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone.
What is the SMILES notation for 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone?
The canonical SMILES for 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone is COc1ccc(C(=O)C(c2c(C)[nH]c3ccccc23)c2c(C)[nH]c3ccccc23)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone?
The InChIKey is WBAWIHWZGDXMQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N2O2/c1-16-24(20-8-4-6-10-22(20)28-16)26(27(30)18-12-14-19(31-3)15-13-18)25-17(2)29-23-11-7-5-9-21(23)25/h4-15,26,28-29H,1-3H3.
What are the key properties of 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone?
1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone has a molecular weight of 408.50 g/mol, XLogP of 6.29, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-2,2-bis(2-methyl-1H-indol-3-yl)ethanone is sourced from PubChem (CID 1020492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).