C16H20O4 — CID 102049384
(3aS,4S,6aS)-4-[(E)-dec-1-en-3-ynyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione (PubChem CID 102049384) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3aS,4S,6aS)-4-[(E)-dec-1-en-3-ynyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione.
| Compound Name | (3aS,4S,6aS)-4-[(E)-dec-1-en-3-ynyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
|---|---|
| PubChem CID | 102049384 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3aS,4S,6aS)-4-[(E)-dec-1-en-3-ynyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
| SMILES | CCCCCCC#C/C=C/[C@@H]1OC(=O)[C@H]2OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C16H20O4/c1-2-3-4-5-6-7-8-9-10-13-12-11-14(17)20-15(12)16(18)19-13/h9-10,12-13,15H,2-6,11H2,1H3/b10-9+/t12-,13-,15-/m0/s1 |
| InChIKey | UNDBYODQBPJTKL-NXBVOPPISA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|