C48H45N7O9 — CID 102049910
methyl 5-[4-[2-[bis[2-[[4-(5-methoxycarbonyl-3-pyridinyl)benzoyl]amino]ethyl]amino]ethylcarbamoyl]phenyl]pyridine-3-carboxylate (PubChem CID 102049910) has the molecular formula C48H45N7O9 and a molecular weight of 863.93 g/mol. Its IUPAC name is methyl 5-[4-[2-[bis[2-[[4-(5-methoxycarbonyl-3-pyridinyl)benzoyl]amino]ethyl]amino]ethylcarbamoyl]phenyl]pyridine-3-carboxylate.
| Compound Name | methyl 5-[4-[2-[bis[2-[[4-(5-methoxycarbonyl-3-pyridinyl)benzoyl]amino]ethyl]amino]ethylcarbamoyl]phenyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102049910 |
| Molecular Formula | C48H45N7O9 |
| Molecular Weight | 863.93 g/mol |
| Exact Mass | 863.33 |
| IUPAC Name | methyl 5-[4-[2-[bis[2-[[4-(5-methoxycarbonyl-3-pyridinyl)benzoyl]amino]ethyl]amino]ethylcarbamoyl]phenyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(-c2ccc(C(=O)NCCN(CCNC(=O)c3ccc(-c4cncc(C(=O)OC)c4)cc3)CCNC(=O)c3ccc(-c4cncc(C(=O)OC)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C48H45N7O9/c1-62-46(59)40-22-37(25-49-28-40)31-4-10-34(11-5-31)43(56)52-16-19-55(20-17-53-44(57)35-12-6-32(7-13-35)38-23-41(29-50-26-38)47(60)63-2)21-18-54-45(58)36-14-8-33(9-15-36)39-24-42(30-51-27-39)48(61)64-3/h4-15,22-30H,16-21H2,1-3H3,(H,52,56)(H,53,57)(H,54,58) |
| InChIKey | QOZLMXMEBSPDNG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 208.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.93 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|