C19H25NO5 — CID 102050060
tert-butyl (4R,7R,8R)-7-methyl-3-oxo-8-phenylmethoxy-2-oxa-5-azaspiro[3.4]octane-5-carboxylate (PubChem CID 102050060) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is tert-butyl (4R,7R,8R)-7-methyl-3-oxo-8-phenylmethoxy-2-oxa-5-azaspiro[3.4]octane-5-carboxylate.
| Compound Name | tert-butyl (4R,7R,8R)-7-methyl-3-oxo-8-phenylmethoxy-2-oxa-5-azaspiro[3.4]octane-5-carboxylate |
|---|---|
| PubChem CID | 102050060 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | tert-butyl (4R,7R,8R)-7-methyl-3-oxo-8-phenylmethoxy-2-oxa-5-azaspiro[3.4]octane-5-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)[C@]2(COC2=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H25NO5/c1-13-10-20(17(22)25-18(2,3)4)19(12-24-16(19)21)15(13)23-11-14-8-6-5-7-9-14/h5-9,13,15H,10-12H2,1-4H3/t13-,15-,19-/m1/s1 |
| InChIKey | XNDIYZCCIWBMKE-ZXYWRSMDSA-N |
| XLogP | 2.75 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|