C16H26O4 — CID 102050110
(2R,4E,6E)-5-methyl-7-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hepta-4,6-diene-1,2-diol (PubChem CID 102050110) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (2R,4E,6E)-5-methyl-7-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hepta-4,6-diene-1,2-diol.
| Compound Name | (2R,4E,6E)-5-methyl-7-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hepta-4,6-diene-1,2-diol |
|---|---|
| PubChem CID | 102050110 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (2R,4E,6E)-5-methyl-7-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hepta-4,6-diene-1,2-diol |
| SMILES | CC(/C=C/[C@H]1CC=C[C@H](OC(C)C)O1)=C\C[C@@H](O)CO |
| InChI | InChI=1S/C16H26O4/c1-12(2)19-16-6-4-5-15(20-16)10-8-13(3)7-9-14(18)11-17/h4,6-8,10,12,14-18H,5,9,11H2,1-3H3/b10-8+,13-7+/t14-,15-,16-/m1/s1 |
| InChIKey | JRDOUPPFUIIBFY-WZKBUORQSA-N |
| XLogP | 2.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|