C13H9Br2N2O- — CID 102050277
2-[(2-amino-5-bromophenyl)iminomethyl]-4-bromophenolate (PubChem CID 102050277) has the molecular formula C13H9Br2N2O- and a molecular weight of 369.04 g/mol. Its IUPAC name is 2-[(2-amino-5-bromophenyl)iminomethyl]-4-bromophenolate.
| Compound Name | 2-[(2-amino-5-bromophenyl)iminomethyl]-4-bromophenolate |
|---|---|
| PubChem CID | 102050277 |
| Molecular Formula | C13H9Br2N2O- |
| Molecular Weight | 369.04 g/mol |
| Exact Mass | 366.91 |
| IUPAC Name | 2-[(2-amino-5-bromophenyl)iminomethyl]-4-bromophenolate |
| SMILES | Nc1ccc(Br)cc1/N=C/c1cc(Br)ccc1[O-] |
| InChI | InChI=1S/C13H10Br2N2O/c14-9-2-4-13(18)8(5-9)7-17-12-6-10(15)1-3-11(12)16/h1-7,18H,16H2/p-1/b17-7+ |
| InChIKey | BRMHXGLIYAUKOD-REZTVBANSA-M |
| XLogP | 3.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.04 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|